Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Argon charged,Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
3-epi-25-Hydroxyvitamin D3is also known as 3-epi-25(OH)D3. It is a metabolite of vitamin D3formed in the liver. 3-epi-25(OH)D3is used as a biomarker to determine the status of vitamin D in the body. It can be also employed as an analytical standard to measure the concentration of 3-epi-25(OH)D3molecules in human serum.
| Canonical Smiles | CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |
|---|---|
| IUPAC Name | 3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| InChIKey | JWUBBDSIWDLEOM-UHFFFAOYSA-N |
| INCHI | 1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3 |
| Isomeric SMILES | CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |
| Molecular Weight | 400.64 |
| Reaxy-Rn | 34003584 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=34003584&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Sensitivity | Light sensitive |
|---|---|
| Melt Point(°C) | -144.0 °C |
| Molecular Weight | 400.600 g/mol |
| XLogP3 | 6.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 400.334 Da |
| Monoisotopic Mass | 400.334 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 655.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 5 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 2 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 1 |