Determine the necessary mass, volume, or concentration for preparing a solution.
≥95 atom% D,≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504772225 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504772225 |
| Canonical Smiles | CN1C=C(C=CC1=O)C(=O)N |
| IUPAC Name | 6-oxo-1-(trideuteriomethyl)pyridine-3-carboxamide |
| InChIKey | JLQSXXWTCJPCBC-FIBGUPNXSA-N |
| INCHI | 1S/C7H8N2O2/c1-9-4-5(7(8)11)2-3-6(9)10/h2-4H,1H3,(H2,8,11)/i1D3 |
| Isomeric SMILES | [2H]C([2H])([2H])N1C=C(C=CC1=O)C(=O)N |
| Molecular Weight | 155.17 |
| Reaxy-Rn | 124385 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=124385&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 10, 2026 | N349303 |
| Solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
|---|---|
| Melt Point(°C) | 200-205° C (dec.) |
| Molecular Weight | 155.170 g/mol |
| XLogP3 | -1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 155.077 Da |
| Monoisotopic Mass | 155.077 Da |
| Topological Polar Surface Area | 63.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 266.000 |
| Isotope Atom Count | 3 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |