Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Stauprimide is an indolocarbazole semi-synthetic small molecule shown to significantly increase the efficiency of directed embryonic stem cell differentiation. Stauprimide inhibits the nuclear localization of NME2, blocking and downregulating c-Myc expression. The expression of c-Myc is crucial for embryonic stem cell self-renewal, and intervention by Stauprimide allows for more efficient lineage-specific differentiation. NME2 is also indicated to be upregulated in certain cancers, indicating further application for the blocking action of Stauprimide
An indolocarbazole promoter of embryonic stem cell differentiation.
| Sonrisas canónicas | CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)C(=O)NC6=O)N(C)C(=O)C9=CC=CC=C9)OC |
|---|---|
| IUPAC Name | N-[(2S,3R,4R,6R)-3-methoxy-2-methyl-16,18-dioxo-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl]-N-methylbenzamide |
| InChIKey | MQCCJEYZKWZQHU-MPRCCEKMSA-N |
| INCHI | 1S/C35H28N4O5/c1-35-31(43-3)23(37(2)34(42)18-11-5-4-6-12-18)17-24(44-35)38-21-15-9-7-13-19(21)25-27-28(33(41)36-32(27)40)26-20-14-8-10-16-22(20)39(35)30(26)29(25)38/h4-16,23-24,31H,17H2,1-3H3,(H,36,40,41)/t23-,24-,31-,35+/m1/s1 |
| Isómeros SMILES | C[C@@]12[C@@H]([C@@H](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)C(=O)NC6=O)N(C)C(=O)C9=CC=CC=C9)OC |
| WGK Alemania | 3 |
| PubChem CID | 46245328 |
| Peso molecular | 584.62 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubilidad | Soluble in DMSO} |
|---|---|
| Sensibilidad | Light sensitive |
| Punto de fusión (°C) | 145°C |
| Peso molecular | 584.600 g/mol |
| XLogP3 | 4.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 584.206 Da |
| Monoisotopic Mass | 584.206 Da |
| Topological Polar Surface Area | 94.800 Ų |
| Heavy Atom Count | 44 |
| Formal Charge | 0 |
| Complexity | 1220.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |