Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
MAT2A inhibitor 1 is a methionine adenosyltransferase 2A (MATA2) inhibitor with an IC 50 less than l00 nM
In Vitro
MAT2A inhibitor 1 (Compound 196) is a safe and effective compound that prevents and manages cancers while reducing or avoiding the toxicities and/or side effects associated with the conventional therapies. The cancers include those that are refractory to standard treatments, such as surgery, radiation therapy, chemotherapy and hormonal therapy. MCE has not independently confirmed the accuracy of these methods. They are for reference only.
Form:Solid
IC50& Target:MATA2
| Sonrisas canónicas | CC1=NC2=C(S1)C=C(C=C2)C3=C(NC4=C(C(=NN4C3=O)C5=CC=CC=C5)C6=CC=CC=C6)NC7=CC=CC=N7 |
|---|---|
| IUPAC Name | 6-(2-methyl-1,3-benzothiazol-6-yl)-2,3-diphenyl-5-(pyridin-2-ylamino)-4H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | ZTNQNZDNHUAVEI-UHFFFAOYSA-N |
| INCHI | 1S/C31H22N6OS/c1-19-33-23-16-15-22(18-24(23)39-19)27-29(34-25-14-8-9-17-32-25)35-30-26(20-10-4-2-5-11-20)28(36-37(30)31(27)38)21-12-6-3-7-13-21/h2-18,35H,1H3,(H,32,34) |
| Isómeros SMILES | CC1=NC2=C(S1)C=C(C=C2)C3=C(NC4=C(C(=NN4C3=O)C5=CC=CC=C5)C6=CC=CC=C6)NC7=CC=CC=N7 |
| PubChem CID | 137296045 |
| Peso molecular | 526.61 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubilidad | DMSO : 5 mg/mL (9.49 mM; Need ultrasonic and warming) |
|---|---|
| Peso molecular | 526.600 g/mol |
| XLogP3 | 7.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 526.158 Da |
| Monoisotopic Mass | 526.158 Da |
| Topological Polar Surface Area | 113.000 Ų |
| Heavy Atom Count | 39 |
| Formal Charge | 0 |
| Complexity | 917.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |