Determine the necessary mass, volume, or concentration for preparing a solution.
≥98 atom% D,≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Levofloxacin-d8 is a labelled S-(-)-Form of Ofloxacin. It is an antibiotic used against gram-negative organisms.
| Pubchem Sid | 504770785 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504770785 |
| Sonrisas canónicas | CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)O |
| IUPAC Name | (2S)-7-fluoro-2-methyl-6-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | GSDSWSVVBLHKDQ-FMBBTWBHSA-N |
| INCHI | 1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m0/s1/i3D2,4D2,5D2,6D2 |
| Isómeros SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])C2=C(C=C3C4=C2OC[C@@H](N4C=C(C3=O)C(=O)O)C)F)([2H])[2H])[2H] |
| CAS alternativo | 100986-85-4(unlabelled) |
| Peso molecular | 369.42 |
| Reaxy-Rn | 3657947 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3657947&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubilidad | Soluble in DMSO |
|---|---|
| Punto de fusión (°C) | 222-224° C (Predicted) |
| Peso molecular | 369.400 g/mol |
| XLogP3 | -0.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 2 |
| Exact Mass | 369.194 Da |
| Monoisotopic Mass | 369.194 Da |
| Topological Polar Surface Area | 73.300 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 634.000 |
| Isotope Atom Count | 8 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Junlie Zhou, Jianglin Kang, Chunyan Lin, Qi Xu, Wanrong Yang, Ke Fan, Jinrong Li. (2024) Antibiotics in Surface Sediments from the Anning River in Sichuan Province, China: Occurrence, Distribution, and Risk Assessment. Toxics, 12 (6): (411). [PMID:38922091] [10.3390/toxics12060411] |