Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Cefradine is a beta-lactam, first-generation cephalosporin antibiotic with bactericidal activity.
| ALogP | -2.484 |
|---|---|
| Recuento HBD | 2 |
| Enlace rotable | 4 |
| Pubchem Sid | 504768967 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768967 |
| Sonrisas canónicas | CC1=C(N2C(C(C2=O)NC(=O)C(C3=CCC=CC3)N)SC1)C(=O)O.O |
| IUPAC Name | (6R,7R)-7-[[(2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate |
| InChIKey | VHNPSPMQGXQSET-CYJZLJNKSA-N |
| INCHI | 1S/C16H19N3O4S.H2O/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9;/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23);1H2/t10-,11-,15-;/m1./s1 |
| Isómeros SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](C3=CCC=CC3)N)SC1)C(=O)O.O |
| PubChem CID | 21124775 |
| Peso molecular | 367.42 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Oct 30, 2025 | C413264 | |
| Certificate of Analysis | Oct 30, 2025 | C413264 | |
| Certificate of Analysis | Oct 30, 2025 | C413264 | |
| Certificate of Analysis | Oct 30, 2025 | C413264 |
| Solubilidad | Solubility (25°C) In vitro Water: 4 mg/mL (10.88 mM); DMSO: Insoluble; Ethanol: -1 mg/mL |
|---|---|
| DMSO (mg/ml) Solubilidad máxima | <1 |
| Agua (mg/ml) Solubilidad máxima | 4 |
| Agua (mM) Solubilidad máxima | 10.8867236405204 |
| Peso molecular | 367.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 367.12 Da |
| Monoisotopic Mass | 367.12 Da |
| Topological Polar Surface Area | 139.000 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 697.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Xizhuang Yue, Xueyan Xu, Chuansheng Liu, Shuang Zhao. (2021) Simultaneous determination of cefotaxime and nimesulide using poly(L-cysteine) and graphene composite modified glassy carbon electrode. MICROCHEMICAL JOURNAL, [PMID:] [10.1016/j.microc.2021.107058] |
| 2. Yingnan Liu, Yaqing Xiao, Min Yu, Yuanyuan Cao, Yalan Zhang, Taotao Zhe, Hui Zhang, Li Wang. (2020) Antimonene Quantum Dots as an Emerging Fluorescent Nanoprobe for the pH-Mediated Dual-Channel Detection of Tetracyclines. Small, 16 (42): (2003429). [PMID:32996281] [10.1002/smll.202003429] |