| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| T161546-1g | 1g | 3 | $18.90 | |
| T161546-5g | 5g | 3 | $69.90 | |
| T161546-25g | 25g | 2 | $344.90 |
| Synonyms | CMLWFCUAXGSMBB-UHFFFAOYSA- | AKOS015851709 | A841325 | Phosphine, tris(2,6-dimethoxyphenyl)- | AS-61743 | SCHEMBL148067 | FT-0655924 | T1614 | Tris(2,6-dimethoxyphenyl)phosphine, 98% | EN300-7379352 | MFCD00192558 | Tris(2,6-dimethoxyphenyl)phosphine | CS |
|---|---|
| Specifications & Purity | ≥97%(HPLC) |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In | Wet ice |
| Pubchem Sid | 504761167 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504761167 |
| IUPAC Name | tris(2,6-dimethoxyphenyl)phosphane |
| INCHI | InChI=1S/C24H27O6P/c1-25-16-10-7-11-17(26-2)22(16)31(23-18(27-3)12-8-13-19(23)28-4)24-20(29-5)14-9-15-21(24)30-6/h7-15H,1-6H3 |
| InChi Key | CMLWFCUAXGSMBB-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C(=CC=C1)OC)P(C2=C(C=CC=C2OC)OC)C3=C(C=CC=C3OC)OC |
| Isomeric SMILES | COC1=C(C(=CC=C1)OC)P(C2=C(C=CC=C2OC)OC)C3=C(C=CC=C3OC)OC |
| WGK Germany | 3 |
| PubChem CID | 2734597 |
| Molecular Weight | 442.45 |
| Reaxy-Rn | 4302254 |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation H335:May cause respiratory irritation |
|---|---|
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. |
| WGK Germany | 3 |
| Reaxy-Rn | 4302254 |
H2119359