The store will not work correctly when cookies are disabled.
Tetraethyl 1,1,2,2-ethanetetracarboxylate , CAS No.632-56-4
Basic Description
Synonyms | Tetraethyl 1,1,2,2-ethanetetracarboxylate | TETRAethyl-1,1,2,2-ETHANETETRACARBOXYLATE | Tetraethyl1,1,2,2-ethanetetracarboxylate | SCHEMBL2460611 | UNII-5G8A5ZPV2T | AI3-11223 | Tetraethyl ethane-1,1,2,2-tetracarboxylate | EINECS 211-180-7 | Tetrakis(etho |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
Pubchem Sid | 488185679 |
IUPAC Name | tetraethyl ethane-1,1,2,2-tetracarboxylate |
INCHI | InChI=1S/C14H22O8/c1-5-19-11(15)9(12(16)20-6-2)10(13(17)21-7-3)14(18)22-8-4/h9-10H,5-8H2,1-4H3 |
InChi Key | UQSBVZIXVVORQC-UHFFFAOYSA-N |
Canonical SMILES | CCOC(=O)C(C(C(=O)OCC)C(=O)OCC)C(=O)OCC |
Isomeric SMILES | CCOC(=O)C(C(C(=O)OCC)C(=O)OCC)C(=O)OCC |
WGK Germany | 3 |
PubChem CID | 79090 |
Molecular Weight | 318.32 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Safety and Hazards(GHS)
WGK Germany | 3 |
RIDADR | NONHforallmodesoftransport |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator