| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B300427-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $687.90 |
| Synonyms | 632-68-8 | Aizen Rose Bengal | Bengal Rose B | Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodo-, dipotassium salt | Food red dye 105 | Bengal Pink B | Bengal Red B | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3- |
|---|---|
| Specifications & Purity | Biochemical |
| Shipped In | Normal |
| IUPAC Name | dipotassium;4,5,6,7-tetrachloro-2',4',5',7'-tetraiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
|---|---|
| INCHI | InChI=1S/C20H4Cl4I4O5.2K/c21-9-7-8(10(22)12(24)11(9)23)20(33-19(7)31)3-1-5(25)15(29)13(27)17(3)32-18-4(20)2-6(26)16(30)14(18)28;;/h1-2,29-30H;;/q;2*+1/p-2 |
| InChi Key | VQHHOXOLUXRQFQ-UHFFFAOYSA-L |
| Canonical SMILES | C1=C2C(=C(C(=C1I)[O-])I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)[O-])I.[K+].[K+] |
| Isomeric SMILES | C1=C2C(=C(C(=C1I)[O-])I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)[O-])I.[K+].[K+] |
| PubChem CID | 71553 |
| Molecular Weight | 1049.8 |
