Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Specifications & Purity | Cation; Viscosity: 3000-5000 (Pa · S), ionicity: 13-17% |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
AI Insight
Names and Identifiers
| IUPAC Name | prop-2-enamide |
|---|---|
| INCHI | InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
| InChi Key | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| Canonical SMILES | C=CC(=O)N |
| Isomeric SMILES | C=CC(=O)N |
| WGK Germany | 1 |
| RTECS | AS3700000 |
| PubChem CID | 6579 |
| Reaxy-Rn | 8613183 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Safety and Hazards(GHS)
| WGK Germany | 1 |
|---|---|
| RTECS | AS3700000 |
| Reaxy-Rn | 8613183 |