| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P287481-10mg | 10mg | 3 | $102.90 | |
| P287481-50mg | 50mg | 2 | $412.90 | |
| P287481-100mg | 100mg | 2 | $739.90 |
Potent and selective BRPF1B bromodomain inhibitor
| Synonyms | N-[2,3-Dihydro-1,3-dimethyl-2-oxo-6-(1-pyrrolidinyl)-1H-benzimidazol-5-yl]-2-methoxybenzamide |
|---|---|
| Specifications & Purity | Moligand™, ≥97% |
| Biochemical and Physiological Mechanisms | Potent and selective BRPF1B bromodomain inhibitor (IC50= 172 nM). Exhibits >100-fold selectivity for BRPF1 over a panel of other bromodomains including BRPF2 (BRD1), BRPF3 and BRD4. Disrupts BRPF1 binding to histone H3.3. Cell permeable. Inhibits osteocla |
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| Grade | Moligand™ |
| Mechanism of action | bromodomain and PHD finger containing 1 |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504770168 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504770168 |
| IUPAC Name | N-(1,3-dimethyl-2-oxo-6-pyrrolidin-1-ylbenzimidazol-5-yl)-2-methoxybenzamide |
| INCHI | InChI=1S/C21H24N4O3/c1-23-17-12-15(22-20(26)14-8-4-5-9-19(14)28-3)16(25-10-6-7-11-25)13-18(17)24(2)21(23)27/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3,(H,22,26) |
| InChi Key | QCIJLRJBZDBVDB-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=C(C=C(C(=C2)NC(=O)C3=CC=CC=C3OC)N4CCCC4)N(C1=O)C |
| Isomeric SMILES | CN1C2=C(C=C(C(=C2)NC(=O)C3=CC=CC=C3OC)N4CCCC4)N(C1=O)C |
| PubChem CID | 40642506 |
| Molecular Weight | 380.44 |
K2212538