| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P160785-5ml | 5ml | 2 | $59.90 | |
| P160785-25ml | 25ml | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $196.90 | |
| P160785-100ml | 100ml | 2 | $653.90 |
| Synonyms | p-Tolyl octanoate | 59558-23-5 | p-Cresyl caprylate | p-Cresyl octanoate | n-Octanoic acid p-tolyl ester | p-Tolyl n-octanoate | 4-Methylphenyl octanoate | (4-methylphenyl) octanoate | Narcissin K | Octanoic acid, 4-methylphenyl ester | OCTANOIC ACID, p-TOLYL ESTER | Methylphe |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
| Pubchem Sid | 504753621 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753621 |
| IUPAC Name | (4-methylphenyl) octanoate |
| INCHI | InChI=1S/C15H22O2/c1-3-4-5-6-7-8-15(16)17-14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3 |
| InChi Key | ALRYNTSLFYRKGF-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC(=O)OC1=CC=C(C=C1)C |
| Isomeric SMILES | CCCCCCCC(=O)OC1=CC=C(C=C1)C |
| RTECS | RH0787500 |
| PubChem CID | 43046 |
| Molecular Weight | 234.34 |
| Reaxy-Rn | 3270557 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302:Harmful if swallowed |
| Precautionary Statements | P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P270:Do not eat, drink or smoke when using this product. P330:Rinse mouth. P301+P317:IF SWALLOWED: Get medical help. |
| RTECS | RH0787500 |
| Reaxy-Rn | 3270557 |
