| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D105957-1g | 1g | 3 | $12.90 | |
| D105957-5g | 5g | 3 | $30.90 | |
| D105957-25g | 25g | 2 | $119.90 | |
| D105957-100g | 100g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $430.90 |
| Synonyms | N,N'-bis[(phenylmethoxy)-carbonyl]-L-cystine | N,N'-bis[(phenylmethoxy)carbonyl]-L-cystine | MFCD00022030 | 2-(((Benzyloxy)carbonyl)amino)-3-(((R)-2-(((benzyloxy)carbonyl)amino)-2-carboxyethyl)disulfanyl)propanoic acid | N,N'-Bis(benzyloxycarbonyl)-L-cyst |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Pubchem Sid | 504758617 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758617 |
| IUPAC Name | (2R)-3-[[(2R)-2-carboxy-2-(phenylmethoxycarbonylamino)ethyl]disulfanyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| INCHI | InChI=1S/C22H24N2O8S2/c25-19(26)17(23-21(29)31-11-15-7-3-1-4-8-15)13-33-34-14-18(20(27)28)24-22(30)32-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,23,29)(H,24,30)(H,25,26)(H,27,28)/t17-,18-/m0/s1 |
| InChi Key | PTRQEEVKHMDMCF-ROUUACIJSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)NC(CSSCC(C(=O)O)NC(=O)OCC2=CC=CC=C2)C(=O)O |
| Isomeric SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2)C(=O)O |
| WGK Germany | 3 |
| PubChem CID | 385972 |
| Molecular Weight | 508.56 |
| Beilstein | 2550640 |
| Reaxy-Rn | 2550640 |
| WGK Germany | 3 |
|---|---|
| Reaxy-Rn | 2550640 |
