| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N587776-250mg | 250mg | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $11.90 | |
| N587776-1g | 1g | 3 | $36.90 | |
| N587776-5g | 5g | 3 | $162.90 |
| Synonyms | 2,2'-((4-Nitrophenyl)azanediyl)diethanol | DTXSID3066340 | 2,2'-[(4-NITROPHENYL)IMINO]BISETHANOL | Ethanol,2'-[(p-nitrophenyl)imino]di- | NS-02842 | (S)-(+)-5-Oxo-2-tetrahydrofuroic Acid | SCHEMBL168393 | UNII-9TAJ327HG4 | 2,2/'-[(4-nitrophenyl)imino]bise |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In | Wet ice |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-nitroanilino]ethanol |
|---|---|
| INCHI | InChI=1S/C10H14N2O4/c13-7-5-11(6-8-14)9-1-3-10(4-2-9)12(15)16/h1-4,13-14H,5-8H2 |
| InChi Key | CDEQUHCAZLSDTD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1N(CCO)CCO)[N+](=O)[O-] |
| Isomeric SMILES | C1=CC(=CC=C1N(CCO)CCO)[N+](=O)[O-] |
| PubChem CID | 87515 |
| Molecular Weight | 226.23 |
Starting at $537.90
K2303617