| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N667984-1mg | 1mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $999.90 | |
| N667984-5mg | 5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $2,999.90 |
| Synonyms | N-(4-Nitrophenyl)acrylamide | N-(4-nitrophenyl)prop-2-enamide | 2-Propenamide, N-(4-nitrophenyl)- | N-[4-Nitrophenyl]Acrylamide | AI3-61974 | EINECS 231-861-2 | N-(4-nitrophenyl)-acrylamide | DTXSID60228304 | BDBM50420531 | MFCD12091233 | AKOS009808895 | |
|---|
| ALogP | 2.3 |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | N-(4-nitrophenyl)prop-2-enamide |
|---|---|
| INCHI | InChI=1S/C9H8N2O3/c1-2-9(12)10-7-3-5-8(6-4-7)11(13)14/h2-6H,1H2,(H,10,12) |
| InChi Key | DFKKBOJXPCXEGX-UHFFFAOYSA-N |
| Canonical SMILES | C=CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
| Isomeric SMILES | C=CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
| PubChem CID | 82198 |
| Molecular Weight | 192.17 |
