The store will not work correctly when cookies are disabled.
Methyl 2,6-dichloro-5-fluoronicotinate - 98%, high purity , CAS No.189281-66-1
Basic Description
Synonyms | METHYL 2,6-DICHLORO-5-FLUORONICOTINATE | 189281-66-1 | methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate | 3-Pyridinecarboxylic acid, 2,6-dichloro-5-fluoro-, methyl ester | MFCD02180634 | SCHEMBL113592 | DTXSID50379536 | WADLLLSMEPLCNO-UHFFFAOYSA-N | AKOS025116799 | AB114 |
Specifications & Purity | ≥98% |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
Pubchem Sid | 504761906 |
Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504761906 |
IUPAC Name | methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate |
INCHI | InChI=1S/C7H4Cl2FNO2/c1-13-7(12)3-2-4(10)6(9)11-5(3)8/h2H,1H3 |
InChi Key | WADLLLSMEPLCNO-UHFFFAOYSA-N |
Canonical SMILES | COC(=O)C1=CC(=C(N=C1Cl)Cl)F |
Isomeric SMILES | COC(=O)C1=CC(=C(N=C1Cl)Cl)F |
PubChem CID | 2775354 |
Molecular Weight | 224 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator