| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| L354314-100mg | 100mg | 8 | $78.90 | |
| L354314-500mg | 500mg | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $237.90 |
| Synonyms | AMY41886 | NSC 118372 | EINECS 213-527-8 | CHEBI:73591 | Leucyltyrosine | leucyl-tyrosine | L-Leu-L-Tyr | SCHEMBL2474675 | A902475 | BDBM50348865 | H-Leu-Tyr-OH | (S)-2-((S)-2-Amino-4-methylpentanamido)-3-(4-hydroxyphenyl)propanoic acid | Q27141905 | AKOS |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504754529 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504754529 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| INCHI | InChI=1S/C15H22N2O4/c1-9(2)7-12(16)14(19)17-13(15(20)21)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8,16H2,1-2H3,(H,17,19)(H,20,21)/t12-,13-/m0/s1 |
| InChi Key | LHSGPCFBGJHPCY-STQMWFEESA-N |
| Canonical SMILES | CC(C)CC(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)N |
| Isomeric SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)N |
| PubChem CID | 70410 |
| Molecular Weight | 294.35 |
C2511394