| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| I425406-1ml | 1ml | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $241.90 |
| Synonyms | isepamicin sulfate | Isepamicin sulphate | 67814-76-0 | Isepacin | Ispallin | Exacin | Isepamicin monosulfate | 393574-17-9 | Isepamicin sulfate [MI] | Isepamicin sulfate [JAN] | Isepamicine sulphate | Isepamicin sulfate [WHO-DD] | Isepamicine (Isepamycin | sch21420) Sulphate | F2L2 |
|---|---|
| Specifications & Purity | 10mM in Water |
| Storage Temp | Store at -80°C |
| Shipped In | Ice chest + Ice pads |
| IUPAC Name | (2S)-3-amino-N-[(1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-[(2R,3R,4R,5R)-3,5-dihydroxy-5-methyl-4-(methylamino)oxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxypropanamide;sulfuric acid |
|---|---|
| INCHI | InChI=1S/C22H43N5O12.H2O4S/c1-22(35)6-36-20(15(33)18(22)26-2)39-17-8(27-19(34)9(28)4-23)3-7(25)16(14(17)32)38-21-13(31)12(30)11(29)10(5-24)37-21;1-5(2,3)4/h7-18,20-21,26,28-33,35H,3-6,23-25H2,1-2H3,(H,27,34);(H2,1,2,3,4)/t7-,8+,9-,10+,11+,12-,13+,14-,15+,16+,17-,18+,20+,21+,22-;/m0./s1 |
| InChi Key | DDXRHRXGIWOVDQ-MGAUJLSLSA-N |
| Canonical SMILES | CC1(COC(C(C1NC)O)OC2C(CC(C(C2O)OC3C(C(C(C(O3)CN)O)O)O)N)NC(=O)C(CN)O)O.OS(=O)(=O)O |
| Isomeric SMILES | C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N)NC(=O)[C@H](CN)O)O.OS(=O)(=O)O |
| PubChem CID | 636375 |
| Molecular Weight | 569.609808 |
