| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| H348249-250mg | 250mg | 2 | $91.90 | |
| H348249-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $256.90 |
| Synonyms | hafnium(4+);disulfate | AKOS025294622 | NXKAMHRHVYEHER-UHFFFAOYSA-J | DTXSID40890765 | Hafnium(IV) sulfate | Hafnium sulfate | Hafnium(IV) sulfate, >=99.9% trace metals basis (purity excludes 1-2% zirconium) | Q4445792 | Sulfuric acid, hafnium(4+) salt (2 |
|---|---|
| Specifications & Purity | ≥99.9% metals basis, excluding Zr,Zr ＜1% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Pubchem Sid | 504767335 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767335 |
| IUPAC Name | hafnium(4+);disulfate |
| INCHI | InChI=1S/Hf.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+4;;/p-4 |
| InChi Key | NXKAMHRHVYEHER-UHFFFAOYSA-J |
| Canonical SMILES | [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Hf+4] |
| Isomeric SMILES | [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Hf+4] |
| PubChem CID | 13094115 |
| Molecular Weight | 370.62 |
A2418289