| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| G333979-25mg | 25mg | 3 | $43.90 | |
| G333979-100mg | 100mg | 3 | $133.90 | |
| G333979-500mg | 500mg | 2 | $532.90 |
a synthetic steroid that acts centrally on the hypothalamic-pituitary system
| Synonyms | 13-ethyl-17-hydroxy-18,19-Dinor-17a-pregna-4,9,11-trien-20-yn-3-one | Gestrinona | Gestrinone | Nemestran | R 2323 | Tridomose | CS-6362 | GESTRINONE [JAN] | GESTRINONE [USAN] | Ru-2323 | GESTRINONE [WHO-DD] | NCGC00167457-01 | Tox21_112461 | CAS-16320-04 |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| Product Description | Gestrinone is a synthetic steroid occasionally used to treat endometriosis. The common disease endometriosis is characterized by the presence of endometrial tissue outside the uterus which affects approximately 10% of premenopausal women. It acts centrally on the hypothalamic-pituitary system to suppress release of lutenizing hormone (LH) and follicle-stimulating hormone (FSH), thus reducing estrogen synthesis. It also binds to androgen (AR), progesterone (PR), and estrogen (ER) receptors in the human endometrial tissue but not to steroid hormone binding globulin or corticord-binding globulin. Gestrinone binds to AR and PR with EC|50|values of approximately 20 and 30 nM, respectively. These values reflect approximately 5-6 fold lower affinity than testosterone and progesterone, the natural AR and PR ligands, for these receptors. |
| pKa | pKₐ: 12.76 (Predicted), 17.88 (Predicted), pKₐ: -1.5 (Predicted) |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504753367 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753367 |
| IUPAC Name | (8S,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| INCHI | InChI=1S/C21H24O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,9,11,13,18-19,23H,3,5-8,10,12H2,1H3/t18-,19+,20+,21+/m1/s1 |
| InChi Key | BJJXHLWLUDYTGC-ANULTFPQSA-N |
| Canonical SMILES | CCC12C=CC3=C4CCC(=O)C=C4CCC3C1CCC2(C#C)O |
| Isomeric SMILES | CC[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(C#C)O |
| RTECS | JF7964000 |
| PubChem CID | 27812 |
| Molecular Weight | 308.4 |
| Beilstein | 5610726 |
| Pictogram(s) | GHS08 |
|---|---|
| Signal | Danger |
| Hazard Statements | H373:Causes damage to organs through prolonged or repeated exposure H360:May damage fertility or the unborn child H361:Suspected of damaging fertility or the unborn child H362:May cause harm to breast-fed children |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P405:Store locked up. P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P260:Do not breathe dust/fume/gas/mist/vapors/spray. P270:Do not eat, drink or smoke when using this product. P263:Avoid contact during pregnancy/while nursing. P203:Obtain, read and follow all safety instructions before use. P318:if exposed or concerned, get medical advice. P319:Get medical help if you feel unwell. |
| RTECS | JF7964000 |
| Merck Index | 3.57152777777778 |
B2218529