| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| G649247-5mg | 5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $490.90 |
Terpenoids Triterpenes
| Synonyms | FT-0775998 | CHEBI:183521 | 6-(3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid | DTXSID101316118 | Ganoderenic Acid B |
|---|---|
| Specifications & Purity | ≥99% |
| Biochemical and Physiological Mechanisms | Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum . Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin. |
| Storage Temp | Store at 2-8°C,Protected from light,Desiccated |
| Shipped In | Wet ice |
| Product Description | Ganoderenic acid B is a lanostane-type triterpene isolated from Ganoderma lucidum. Ganoderenic acid B exhibits potent reversal effect on ABCB1-mediated multidrug resistance of HepG2/ADM cells to Doxorubicin. Form:Solid |
| IUPAC Name | 6-(3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid |
|---|---|
| INCHI | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-22,32,34H,8-9,11-14H2,1-7H3,(H,36,37) |
| InChi Key | QECQJYAIIIIKJB-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O |
| Isomeric SMILES | CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C)C(=O)O |
| Alternate CAS | 100665-41-6 |
| PubChem CID | 78074039 |
| Molecular Weight | 514.65 |
