The store will not work correctly when cookies are disabled.
Ethyl 3-hydroxycyclohexanecarboxylate - 98%, high purity , CAS No.94160-25-5
Basic Description
Synonyms | SB23091 | A916752 | CS-0197525 | Ethyl3-hydroxycyclohexanecarboxylate | BGAOLPQGOBDXBH-UHFFFAOYSA-N | Ethyl 3-hydroxycyclohexanecarboxylate | ETHYL 3-HYDROXY-CYCLOHEXANECARBOXYLATE | SB23090 | SY343919 | EINECS 303-308-6 | ethyl 3-hydroxycyclohexane-1-car |
Specifications & Purity | ≥98% |
---|
Names and Identifiers
IUPAC Name | ethyl 3-hydroxycyclohexane-1-carboxylate |
INCHI | InChI=1S/C9H16O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h7-8,10H,2-6H2,1H3 |
InChi Key | BGAOLPQGOBDXBH-UHFFFAOYSA-N |
Canonical SMILES | CCOC(=O)C1CCCC(C1)O |
Isomeric SMILES | CCOC(=O)C1CCCC(C1)O |
WGK Germany | 3 |
PubChem CID | 3023897 |
Molecular Weight | 172.22 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Safety and Hazards(GHS)
WGK Germany | 3 |
RIDADR | NONHforallmodesoftransport |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator