| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| E769076-250g | 250g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $81.90 |
| Specifications & Purity | ≥50% |
|---|---|
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| IUPAC Name | azanium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
|---|---|
| INCHI | InChI=1S/C10H16N2O8.Fe.H3N/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H3/q;+3;/p-3 |
| InChi Key | XNSQZBOCSSMHSZ-UHFFFAOYSA-K |
| Canonical SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[NH4+].[Fe+3] |
| Isomeric SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[NH4+].[Fe+3] |
| Alternate CAS | 21265-50-9,15275-07-7 (Parent) |
| PubChem CID | 88842 |
| MeSH Entry Terms | ammonium ferric edetate;EDTA Fe(III);EDTA ferric ammonium;Fe(III)-EDTA;Fe(III)-edta complex (1:1);Fe(III)-EDTA, ammonium salt;Fe(III)-EDTA, potassium salt;Fe(III)-EDTA, sodium salt;Fe(III)-EDTA, sodium salt, trihydrate;ferrate(1-), ((ethylenedinitrilo)tet |
