| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D114941-100mg | 100mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $669.90 |
| Synonyms | D-Phenothrin | 26046-85-5 | (1R)-trans-Phenothrin | d-trans-Phenothrin | (-)-trans-Phenothrin | 1R-trans-Phenothrin | phenothrin [(1R)-trans- isomer] | 6JX527V7HJ | (1R,3R)-3-Phenoxybenzyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | (3-phenoxyphenyl)me |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
| IUPAC Name | (3-phenoxyphenyl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C23H26O3/c1-16(2)13-20-21(23(20,3)4)22(24)25-15-17-9-8-12-19(14-17)26-18-10-6-5-7-11-18/h5-14,20-21H,15H2,1-4H3/t20-,21+/m1/s1 |
| InChi Key | SBNFWQZLDJGRLK-RTWAWAEBSA-N |
| Canonical SMILES | CC(=CC1C(C1(C)C)C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C |
| Isomeric SMILES | CC(=C[C@@H]1[C@H](C1(C)C)C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C |
| PubChem CID | 91581 |
| Molecular Weight | 350.46 |
