The store will not work correctly when cookies are disabled.
Basic Description
Specifications & Purity | UltraBio™, anhydrous, ≥99.5%(HPLC), sum of enantiomers |
Storage Temp | Room temperature |
Shipped In | Normal |
Grade | anhydrous, UltraBio™ |
---|
Names and Identifiers
PH | 5.0-7.0 (25 °C, 1 M in H 2 O) |
IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
INCHI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1 |
InChi Key | GZCGUPFRVQAUEE-SLPGGIOYSA-N |
Canonical SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
WGK Germany | 1 |
RTECS | LZ6600000 |
PubChem CID | 107526 |
Molecular Weight | 180.16 |
Beilstein | 1724615 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Safety and Hazards(GHS)
WGK Germany | 1 |
RTECS | LZ6600000 |
Merck Index | 4459 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator