| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C153977-200mg | 200mg | 3 | $103.90 | |
| C153977-1g | 1g | 3 | $352.90 |
| Synonyms | SCHEMBL11938166 | DTXSID80361469 | Ethyl 1,1,7,7-tetramethyl-11-oxo-2,3,5,6,7,11-hexahydro-1H-pyrano[2,3-f]pyrido[3,2,1-ij]quinoline-10-carboxylate | Coumarin 314T | MFCD00144013 | ethyl 10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013, |
|---|---|
| Specifications & Purity | ≥98%(HPLC)(N) |
| Shipped In | Normal |
| Pubchem Sid | 504760446 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760446 |
| IUPAC Name | ethyl 10,10,16,16-tetramethyl-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxylate |
| INCHI | InChI=1S/C22H27NO4/c1-6-26-19(24)14-11-13-12-15-17-16(18(13)27-20(14)25)22(4,5)8-10-23(17)9-7-21(15,2)3/h11-12H,6-10H2,1-5H3 |
| InChi Key | VQQDHBUBOPTRBY-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CC2=CC3=C4C(=C2OC1=O)C(CCN4CCC3(C)C)(C)C |
| Isomeric SMILES | CCOC(=O)C1=CC2=CC3=C4C(=C2OC1=O)C(CCN4CCC3(C)C)(C)C |
| PubChem CID | 1268215 |
| Molecular Weight | 369.46 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H319:Causes serious eye irritation |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P264+P265:Wash hands [and …] thoroughly after handling. Do not touch eyes. P337+P317:If eye irritation persists: Get medical help. |
J2228233