| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| C347194-5mg | 5mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $285.90 |
| Synonyms | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]carbamate | 1228182-48-6 | Cambendazole D7 (isopropyl D7) | DTXSID40746859 | Cambendazole-d7 | 1,1,1,2,3,3,3-Heptadeuteriopropan-2-yl N-[2-(1,3-thiazol-4-yl)-1H-benzimidaz |
|---|---|
| Shipped In | Normal |
| IUPAC Name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]carbamate |
|---|---|
| INCHI | InChI=1S/C14H14N4O2S/c1-8(2)20-14(19)16-9-3-4-10-11(5-9)18-13(17-10)12-6-21-7-15-12/h3-8H,1-2H3,(H,16,19)(H,17,18)/i1D3,2D3,8D |
| InChi Key | QZWHWHNCPFEXLL-UNAVHCQLSA-N |
| Canonical SMILES | CC(C)OC(=O)NC1=CC2=C(C=C1)N=C(N2)C3=CSC=N3 |
| Isomeric SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC(=O)NC1=CC2=C(C=C1)N=C(N2)C3=CSC=N3 |
| PubChem CID | 71312531 |
| Molecular Weight | 309.39 |
| Pictogram(s) | GHS08 |
|---|---|
| Signal | Warning |
| Hazard Statements | H361:Suspected of damaging fertility or the unborn child |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P405:Store locked up. P501:Dispose of contents/container to ... P203:Obtain, read and follow all safety instructions before use. P318:if exposed or concerned, get medical advice. |
