| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B167901-50mg | 50mg | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $410.90 |
| Synonyms | Butyl ethyl malonate | 17373-84-1 | Propanedioic acid, butyl ethyl ester | Ethyl butyl malonate | 3-O-butyl 1-O-ethyl propanedioate | Butyl ethyl propanedioate | Malonic acid, butyl ethyl ester | FEMA No. 2195 | D4AGC486TU | Propanedioic acid, 1-butyl 3-ethyl ester | UNII-D4 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 3-O-butyl 1-O-ethyl propanedioate |
|---|---|
| INCHI | InChI=1S/C9H16O4/c1-3-5-6-13-9(11)7-8(10)12-4-2/h3-7H2,1-2H3 |
| InChi Key | IHVVZSPWQJWRDV-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)CC(=O)OCC |
| Isomeric SMILES | CCCCOC(=O)CC(=O)OCC |
| PubChem CID | 5140436 |
| Molecular Weight | 188.225 |
