| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B152861-1g | 1g | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $30.90 | |
| B152861-5g | 5g | 9 | $74.90 | |
| B152861-25g | 25g | 5 | $135.90 |
| Synonyms | 10-Benzoyl-3,7-bis(dimethylamino)-10H-phenothiazine | N-benzoylleuco methylene blue | 4-aminomethylbenzylalcohol | Benzoylleucomethyleneblue | B0207 | N-Benzoylleucomethylene Blue | Benzoylleukomethylene blue | Methanone, [3,7-bis(dimethylamino)-10H-pheno |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone |
|---|---|
| INCHI | InChI=1S/C23H23N3OS/c1-24(2)17-10-12-19-21(14-17)28-22-15-18(25(3)4)11-13-20(22)26(19)23(27)16-8-6-5-7-9-16/h5-15H,1-4H3 |
| InChi Key | ZKURGBYDCVNWKH-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)N(C3=C(S2)C=C(C=C3)N(C)C)C(=O)C4=CC=CC=C4 |
| Isomeric SMILES | CN(C)C1=CC2=C(C=C1)N(C3=C(S2)C=C(C=C3)N(C)C)C(=O)C4=CC=CC=C4 |
| PubChem CID | 94975 |
| Molecular Weight | 389.52 |
G2131113