| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A137613-5mg | 5mg | 3 | $43.90 | |
| A137613-25mg | 25mg | 2 | $106.90 | |
| A137613-100mg | 100mg | 2 | $167.90 |
| Synonyms | BCP23751 | UPCMLD-DP061:001 | Auraptene | UNII-F79I1ZEL2E | NSC711511 | NSC-711511 | 7-(3,7-Dimethyl-octa-2,6-dienyloxy)-chromen-2-one | NCGC00096070-01 | (E)-7-((3,7-Dimethylocta-2,6-dien-1-yl)oxy)-2H-chromen-2-one | SR-01000758940 | DTXSID80897576 | ACo |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
| Biochemical and Physiological Mechanisms | Auraptene is an estrogen receptor modulator that also acts as an ACAT inhibitor. It displays anti-tumor effects in several xenograft and chemically-induced murine tumor models. Auraptene induces apoptosis and is anti-proliferative in cancer cell lines. It |
| Storage Temp | Store at -20°C |
| Shipped In | Ice chest + Ice pads |
| Product Description | Auraptene (7-geranyloxycoumarin) is a prenyloxycoumarin, that is abundantly present in nature. It is produced by several plant species, such as Rutaceae and Umbeliferae (Apiaceae) families |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504760598 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760598 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
| INCHI | InChI=1S/C19H22O3/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16-8-10-19(20)22-18(16)13-17/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+ |
| InChi Key | RSDDHGSKLOSQFK-RVDMUPIBSA-N |
| Canonical SMILES | CC(=CCCC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)C |
| Isomeric SMILES | CC(=CCC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)C |
| WGK Germany | 3 |
| RTECS | MD6500000 |
| PubChem CID | 1550607 |
| Molecular Weight | 298.38 |
| Pictogram(s) | GHS06, GHS08 |
|---|---|
| Signal | Danger |
| Hazard Statements | H301:Toxic if swallowed H361:Suspected of damaging fertility or the unborn child |
| Precautionary Statements | P301+P310:IF SWALLOWED: Immediately call a POISON CENTER/doctor/... P281:Use personal protective equipment as required. |
| WGK Germany | 3 |
| RTECS | MD6500000 |
K2125633