| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| P334763-1g | 1g | 8 | $169.90 | |
| P334763-5g | 5g | 6 | $760.90 | |
| P334763-25g | 25g | 1 | $3,424.90 | |
| P334763-100g | 100g | 1 | $12,327.90 |
| Synonyms | Diphenylmethyl (6R,7R)-3-hydroxy-8-oxo-7-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | EC 611-177-4 | Benzhydryl(6R,7R)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 3(6R,7R)-Hydrox |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Pubchem Sid | 504771385 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771385 |
| IUPAC Name | benzhydryl (6R,7R)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| INCHI | InChI=1S/C28H24N2O5S/c31-21-17-36-27-23(29-22(32)16-18-10-4-1-5-11-18)26(33)30(27)24(21)28(34)35-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,23,25,27,31H,16-17H2,(H,29,32)/t23-,27-/m1/s1 |
| InChi Key | HJINVAQLVZRFTL-YIXXDRMTSA-N |
| Canonical SMILES | C1C(=C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)OC(C4=CC=CC=C4)C5=CC=CC=C5)O |
| Isomeric SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)OC(C4=CC=CC=C4)C5=CC=CC=C5)O |
| PubChem CID | 54721268 |
| Molecular Weight | 500.58 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 B2218566 | Certificate of Analysis | Dec 19, 2024 | P334763 |
| B2218552 | Certificate of Analysis | Dec 19, 2024 | P334763 |
| B2218551 | Certificate of Analysis | Dec 10, 2024 | P334763 |
| B2218563 | Certificate of Analysis | Dec 10, 2024 | P334763 |
