| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N355649-25mg | 25mg | 3 | $274.90 | |
| N355649-100mg | 100mg | 3 | $686.90 |
| Synonyms | 6-nitroso-2H-chromen-2-one | 6-Nitrosocoumarin | NCGC00094193-01 | NCGC00261554-01 | Lopac0_000869 | SR-01000076033-1 | HMS3262N19 | SR-01000076033 | 6-Nitroso-1,2-benzopyrone | EU-0100869 | N 8403 | 6-nitrosochromen-2-one | DTXSID90156580 | SDCCGSBI-0050 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at -20°C,Argon charged |
| Shipped In | Ice chest + Ice pads |
| Product Description | 6-Nitroso-1,2-benzopyrone binds to the DNA-recognizing domain of ADP-ribosyltransferase and preferentially destabilizes one of the two zinc finger polypeptide complexes. The affected enzyme loses almost all activity, but still binds to DNA. |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504750514 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504750514 |
| IUPAC Name | 6-nitrosochromen-2-one |
| INCHI | InChI=1S/C9H5NO3/c11-9-4-1-6-5-7(10-12)2-3-8(6)13-9/h1-5H |
| InChi Key | HXTDAUGEZTYMGP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=CC(=O)O2)C=C1N=O |
| Isomeric SMILES | C1=CC2=C(C=CC(=O)O2)C=C1N=O |
| PubChem CID | 1871 |
| Molecular Weight | 175.14 |
H2213228