| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M157950-1g | 1g | 3 | $24.90 | |
| M157950-5g | 5g | 3 | $73.90 | |
| M157950-25g | 25g | 3 | $269.90 |
| Synonyms | AKOS009156596 | SCHEMBL487461 | ETHYL2-[(ANILINOCARBOTHIOYL)AMINO]ACETATE | FT-0620588 | D91415 | M0961 | AS-77602 | EN300-1250317 | 5-methyl-hex-1-yn-3-ol | 5-methylhex-1-yn-3-ol | 5-Methyl-1-hexyn-3-ol | MFCD00041606 | DTXSID90977535 | 5-Methyl-1-hexyn- |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Pubchem Sid | 504757267 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504757267 |
| IUPAC Name | 5-methylhex-1-yn-3-ol |
| INCHI | InChI=1S/C7H12O/c1-4-7(8)5-6(2)3/h1,6-8H,5H2,2-3H3 |
| InChi Key | NTNUBJHPRAMQPC-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC(C#C)O |
| Isomeric SMILES | CC(C)CC(C#C)O |
| WGK Germany | 3 |
| PubChem CID | 143856 |
| Molecular Weight | 112.17 |
| Reaxy-Rn | 1741083 |
| Pictogram(s) | GHS07, GHS02 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302:Harmful if swallowed H226:Flammable liquid and vapor |
| Precautionary Statements | P280:Wear protective gloves/protective clothing/eye protection/face protection. P370+P378:In case of fire: Use ... to extinguish. P210:Keep away from heat, hot surface, sparks, open flames and other ignition sources. - No smoking. P501:Dispose of contents/container to ... P233:Keep container tightly closed. P240:Ground/bond container and receiving equipment. P264:Wash hands [and …] thoroughly after handling. P403+P235:Store in a well-ventilated place. Keep cool. P303+P361+P353:IF ON SKIN (or hair): Take off Immediately all contaminated clothing. Rinse SKIN with water [or shower]. P241:Use explosion-proof [electrical/ventilating/lighting/.../] equipment. P270:Do not eat, drink or smoke when using this product. P330:Rinse mouth. P242:Use only non-sparking tools. P243:Take precautionary measures against static discharge. P301+P317:IF SWALLOWED: Get medical help. |
| WGK Germany | 3 |
| Reaxy-Rn | 1741083 |
H2215167