| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A196139-100mg | 100mg | 3 | $89.90 | |
| A196139-250mg | 250mg | 3 | $154.90 | |
| A196139-1g | 1g | 3 | $343.90 | |
| A196139-5g | 5g | 2 | $1,029.90 | |
| A196139-25g | 25g | 2 | $3,089.90 |
| Synonyms | DTXSID601020538 | Sulfanilamide, N(1)-(5-methyl-3-isoxazolyl)- | 16-beta-Methyl epoxide | AKOS017343721 | 9beta,11beta-Epoxy-17,21-dihydroxy-16beta-methylpregna-1,4-diene-3,20-dione | 5-25-12-00525 (Beilstein Handbook Reference) | M9AY9BSI41 | Q27283711 | |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In | Wet ice |
| Pubchem Sid | 504756502 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504756502 |
| IUPAC Name | (1S,2S,10S,11S,13S,14R,15S,17S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one |
| INCHI | InChI=1S/C22H28O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)22(15)18(27-22)10-20(16,3)21(12,26)17(25)11-23/h6-7,9,12,15-16,18,23,26H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,18-,19-,20-,21-,22+/m0/s1 |
| InChi Key | GBDXNHBVYAMODG-DEGNENOVSA-N |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C35C(O5)CC2(C1(C(=O)CO)O)C)C |
| Isomeric SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]35[C@@H](O5)C[C@@]2([C@]1(C(=O)CO)O)C)C |
| PubChem CID | 101933 |
| Molecular Weight | 372.44 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 F2209209 | Certificate of Analysis | Mar 04, 2025 | A196139 |
| F2209211 | Certificate of Analysis | Mar 04, 2025 | A196139 |
| F2209212 | Certificate of Analysis | Mar 04, 2025 | A196139 |
| F2209213 | Certificate of Analysis | Mar 04, 2025 | A196139 |
| F2209214 | Certificate of Analysis | Mar 04, 2025 | A196139 |
