The store will not work correctly when cookies are disabled.
4-Nitro-p-terphenyl - 95%, high purity , CAS No.10355-53-0
Basic Description
Synonyms | NSC 506434 | N0610 | 4-Nitro-(para-terphenyl) | MFCD00044846 | 1,1':4',1''-TERPHENYL, 4-NITRO- | 3-05-00-02299 (Beilstein Handbook Reference) | IMMGNSJGTWWGJB-UHFFFAOYSA-N | AS-59851 | 4-Nitro-p-terphenyl | FT-0636689 | 1,1''-Terphenyl, 4-nitro- | BRN 221 |
Specifications & Purity | ≥95% |
Shipped In | Normal |
---|
Names and Identifiers
Pubchem Sid | 504753299 |
Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753299 |
IUPAC Name | 1-(4-nitrophenyl)-4-phenylbenzene |
INCHI | InChI=1S/C18H13NO2/c20-19(21)18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13H |
InChi Key | IMMGNSJGTWWGJB-UHFFFAOYSA-N |
Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Isomeric SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
RTECS | WZ6525000 |
PubChem CID | 25196 |
Molecular Weight | 275.31 |
Reaxy-Rn | 2217021 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Safety and Hazards(GHS)
RTECS | WZ6525000 |
Reaxy-Rn | 2217021 |
---|
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator