| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| M186478-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $630.90 |
| Synonyms | (4-methoxyphenyl)(piperidin-4-yl)methanone | 76362-12-4 | 4-(4-methoxybenzoyl)piperidine | 4-(4-Methoxybenzoyl)-piperidine | (4-methoxyphenyl)-piperidin-4-ylmethanone | Maybridge1_007834 | Oprea1_599934 | SCHEMBL230405 | DTXSID70372382 | ZYKYHSIACDLOCE-UHFFFAOYSA-N | CS-M291 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | (4-methoxyphenyl)-piperidin-4-ylmethanone |
|---|---|
| INCHI | InChI=1S/C13H17NO2/c1-16-12-4-2-10(3-5-12)13(15)11-6-8-14-9-7-11/h2-5,11,14H,6-9H2,1H3 |
| InChi Key | ZYKYHSIACDLOCE-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)C2CCNCC2 |
| Isomeric SMILES | COC1=CC=C(C=C1)C(=O)C2CCNCC2 |
| PubChem CID | 2740588 |
| Molecular Weight | 219.3 |
