| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A111608-25g | 25g | 4 | $24.90 | |
| A111608-100g | 100g | 4 | $76.90 | |
| A111608-500g | 500g | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $292.90 |
| Synonyms | Q27257203 | AS-57673 | AKOS024272189 | 4-Aminobenzoic acid, sodium salt | Benzoic acid, p-amino-, sodium salt | UNII-75UI7QUZ5J | Benzoic acid, p-amino-, monosodium salt | 75UI7QUZ5J | SODIUM AMINOBENZOATE [MART.] | sodium 4-azanylbenzoate | Sodium p-amin |
|---|---|
| Specifications & Purity | ≥99% |
| Storage Temp | Desiccated |
| Shipped In | Normal |
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 488189977 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488189977 |
| IUPAC Name | sodium;4-aminobenzoate |
| INCHI | InChI=1S/C7H7NO2.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1 |
| InChi Key | XETSAYZRDCRPJY-UHFFFAOYSA-M |
| Canonical SMILES | C1=CC(=CC=C1C(=O)[O-])N.[Na+] |
| Isomeric SMILES | C1=CC(=CC=C1C(=O)[O-])N.[Na+] |
| WGK Germany | 3 |
| RTECS | DG2975000 |
| PubChem CID | 517441 |
| Molecular Weight | 159.12 |
| Beilstein | 14418 |
| Reaxy-Rn | 4163974 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H315:Causes skin irritation H319:Causes serious eye irritation H335:May cause respiratory irritation |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P264:Wash hands [and …] thoroughly after handling. P271:Use only outdoors or in a well-ventilated area. |
| WGK Germany | 3 |
| RTECS | DG2975000 |
| Reaxy-Rn | 4163974 |
| 1. Wenlong Zhang, Lan Wang, Hanxiang Li, Penghai Xu, Fei Yi, Ying Chen, Xingwen Liu, Longyao Wang. (2023) A Gemini viscoelastic surfactant stabilized by steric hindrance group on its spacer to construct wormlike micelle structure in concentrated brines. JOURNAL OF MOLECULAR LIQUIDS, 385 (122275). [PMID:] [10.1016/j.molliq.2023.122275] |
| 1. Wenlong Zhang, Lan Wang, Hanxiang Li, Penghai Xu, Fei Yi, Ying Chen, Xingwen Liu, Longyao Wang. (2023) A Gemini viscoelastic surfactant stabilized by steric hindrance group on its spacer to construct wormlike micelle structure in concentrated brines. JOURNAL OF MOLECULAR LIQUIDS, 385 (122275). [PMID:] [10.1016/j.molliq.2023.122275] |
B2325244