| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| Z174309-10mg | 10mg | 2 | $14.90 | |
| Z174309-50mg | 50mg | 3 | $35.90 | |
| Z174309-250mg | 250mg | 3 | $110.90 | |
| Z174309-1g | 1g | 3 | $275.90 | |
| Z174309-5g | 5g | 3 | $962.90 |
| Synonyms | 147085-13-0 | 4-amino-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride | 1,2,5-Oxadiazole-3-carboximidoyl chloride, 4-amino-N-hydroxy- | (Z)-4-amino-N-hydroxy-1,2,5-oxadiazole-3-carbonimidoyl chloride | (E)-4-Amino-N-hydroxy-1,2,5-oxadiazole-3-carbimidoyl chlo |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Pubchem Sid | 488194653 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488194653 |
| IUPAC Name | 4-amino-N-hydroxy-1,2,5-oxadiazole-3-carboximidoyl chloride |
| INCHI | InChI=1S/C3H3ClN4O2/c4-2(6-9)1-3(5)8-10-7-1/h9H,(H2,5,8) |
| InChi Key | LVNWHKAEEDWAGF-UHFFFAOYSA-N |
| Canonical SMILES | C1(=NON=C1N)C(=NO)Cl |
| Isomeric SMILES | C1(=NON=C1N)C(=NO)Cl |
| PubChem CID | 4040027 |
| Molecular Weight | 162.535 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302:Harmful if swallowed H312:Harmful in contact with skin H332:Harmful if inhaled |
| Precautionary Statements | P261:Avoid breathing dust/fume/gas/mist/vapors/spray. P280:Wear protective gloves/protective clothing/eye protection/face protection. P302+P352:IF ON SKIN: wash with plenty of water. P321:Specific treatment (see ... on this label). P501:Dispose of contents/container to ... P264:Wash hands [and …] thoroughly after handling. P271:Use only outdoors or in a well-ventilated area. P270:Do not eat, drink or smoke when using this product. P304+P340:IF INHALED: Remove person to fresh air and keep comfortable for breathing. P362+P364:Take off contaminated clothing and wash it before reuse. P330:Rinse mouth. P301+P317:IF SWALLOWED: Get medical help. P317:Get emergency medical help. |
G1820060