| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| D587687-100mg | 100mg | 3 | $26.90 | |
| D587687-250mg | 250mg | 3 | $54.90 | |
| D587687-1g | 1g | Available within 4-8 weeks(?) Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience! | $178.90 |
| Synonyms | MFCD00233879 | AC-20759 | Q-101882 | BS-21813 | CS-0085711 | A812167 | AC-30729 | 4,4'-Dichloro-2,2'-bipyridine | AKOS015918373 | 4-chloro-2-(4-chloropyridin-2-yl)pyridine | FT-0653405 | 4,4'-Dichloro-[2,2']bipyridinyl | AM84621 | 2,2'-Bipyridine, 4,4'-di |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In | Wet ice |
| IUPAC Name | 4-chloro-2-(4-chloropyridin-2-yl)pyridine |
|---|---|
| INCHI | InChI=1S/C10H6Cl2N2/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H |
| InChi Key | UBSRTSGCWBPLQF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CN=C(C=C1Cl)C2=NC=CC(=C2)Cl |
| Isomeric SMILES | C1=CN=C(C=C1Cl)C2=NC=CC(=C2)Cl |
| PubChem CID | 137200 |
| Molecular Weight | 225.07 |
I2307239