| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| N180905-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $1,175.90 |
| Synonyms | 3-(Naphthalen-1-yl)-5-nitrobenzoic acid | 1261964-85-5 | 3-naphthalen-1-yl-5-nitrobenzoic acid | 3-(Naphthalen-1-yl)-5-nitrobenzoicacid | DTXSID70690977 | MFCD18321576 | AKOS015888908 | BS-20312 | Benzoic acid, 3-(1-naphthalenyl)-5-nitro- | CS-0210794 | A889530 |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 3-naphthalen-1-yl-5-nitrobenzoic acid |
|---|---|
| INCHI | InChI=1S/C17H11NO4/c19-17(20)13-8-12(9-14(10-13)18(21)22)16-7-3-5-11-4-1-2-6-15(11)16/h1-10H,(H,19,20) |
| InChi Key | FRPXBPYOTQZIDD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=CC(=C3)[N+](=O)[O-])C(=O)O |
| Isomeric SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC(=CC(=C3)[N+](=O)[O-])C(=O)O |
| PubChem CID | 53227442 |
| Molecular Weight | 294.3 |
