| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B187214-1g | 1g | 3 | $23.90 | |
| B187214-5g | 5g | 3 | $81.90 | |
| B187214-25g | 25g | 2 | $368.90 |
| Synonyms | 3-BROMO-4-(1H-IMIDAZOL-1-YL)BENZALDEHYDE | 861932-08-3 | 3-Bromo-4-(1-imidazolyl)benzaldehyde | 3-bromo-4-imidazol-1-ylbenzaldehyde | MFCD11656797 | SCHEMBL1610383 | DTXSID50700189 | MWRSHCXIXJNGGF-UHFFFAOYSA-N | AKOS015950495 | 3-bromo-(4-imidazol-1-yl)benzaldehyde | DS-165 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In | Wet ice |
| Pubchem Sid | 504771248 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771248 |
| IUPAC Name | 3-bromo-4-imidazol-1-ylbenzaldehyde |
| INCHI | InChI=1S/C10H7BrN2O/c11-9-5-8(6-14)1-2-10(9)13-4-3-12-7-13/h1-7H |
| InChi Key | MWRSHCXIXJNGGF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C=O)Br)N2C=CN=C2 |
| Isomeric SMILES | C1=CC(=C(C=C1C=O)Br)N2C=CN=C2 |
| PubChem CID | 53429590 |
| Molecular Weight | 251.1 |
| Pictogram(s) | GHS07 |
|---|---|
| Signal | Warning |
| Hazard Statements | H302:Harmful if swallowed |
| Precautionary Statements | P305+P351+P338:IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses if present and easy to do - continue rinsing. P280:Wear protective gloves/protective clothing/eye protection/face protection. |
K2216385