| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B187140-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $700.90 |
| Synonyms | (3-(Benzylthio)phenyl)boronic acid | 854778-48-6 | 3-(Benzylthio)phenylboronic acid | (3-benzylsulfanylphenyl)boronic acid | [3-(Benzylsulfanyl)phenyl]boronic acid | (3-(Benzylthio)phenyl)boronicacid | SCHEMBL1124799 | DTXSID40718233 | 3-Benzylsulfanylphenylboronic acid | |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | (3-benzylsulfanylphenyl)boronic acid |
|---|---|
| INCHI | InChI=1S/C13H13BO2S/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9,15-16H,10H2 |
| InChi Key | RVFUWXHBQUHFJW-UHFFFAOYSA-N |
| Canonical SMILES | B(C1=CC(=CC=C1)SCC2=CC=CC=C2)(O)O |
| Isomeric SMILES | B(C1=CC(=CC=C1)SCC2=CC=CC=C2)(O)O |
| PubChem CID | 56737640 |
| Molecular Weight | 244.1 |
