The store will not work correctly when cookies are disabled.
3-(1,4-Dioxaspiro[4.5]dec-7-en-8-yl)-1H-indole , CAS No.143165-32-6
Basic Description
Synonyms | 3-(1,4-Dioxaspiro[4.5]dec-7-en-8-yl)-1H-indole | 143165-32-6 | 3-{1,4-dioxaspiro[4.5]dec-7-en-8-yl}-1H-indole | SCHEMBL6634925 | DTXSID50377173 | BOSKLOMTRITQHA-UHFFFAOYSA-N | MFCD06411611 | AKOS005070327 | CS-0318529 | 3Y-0246 | 4-(1H-3-indolyl)-3-cyclohexenone ethylene ket |
Storage Temp | Room temperature |
Shipped In | Normal |
---|
Names and Identifiers
IUPAC Name | 3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-1H-indole |
INCHI | InChI=1S/C16H17NO2/c1-2-4-15-13(3-1)14(11-17-15)12-5-7-16(8-6-12)18-9-10-19-16/h1-5,11,17H,6-10H2 |
InChi Key | BOSKLOMTRITQHA-UHFFFAOYSA-N |
Canonical SMILES | C1CC2(CC=C1C3=CNC4=CC=CC=C43)OCCO2 |
Isomeric SMILES | C1CC2(CC=C1C3=CNC4=CC=CC=C43)OCCO2 |
PubChem CID | 2763857 |
Molecular Weight | 255.31 |
---|
Certificates(CoA,COO,BSE/TSE and Analysis Chart)
Solution Calculators
Molarity Calculator
Determine the necessary mass, volume, or concentration for preparing a solution.
Dilution Calculator
Determine the dilution needed to prepare a stock solution.
Reconstitution Calculator