| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| E184582-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $1,350.90 |
| Synonyms | 2-Ethoxy-5-(tributylstannyl)thiazole | 446285-61-6 | 2-ethoxy-5-(tributylstannyl)-1,3-thiazole | tributyl-(2-ethoxy-1,3-thiazol-5-yl)stannane | MFCD09025788 | 5-(Tributylstannyl)-2-ethoxythiazole | SCHEMBL1763533 | DTXSID40586030 | HKTFMFBUSSUPGJ-UHFFFAOYSA-N | WSA28561 | AK |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | tributyl-(2-ethoxy-1,3-thiazol-5-yl)stannane |
|---|---|
| INCHI | InChI=1S/C5H6NOS.3C4H9.Sn/c1-2-7-5-6-3-4-8-5;3*1-3-4-2;/h3H,2H2,1H3;3*1,3-4H2,2H3; |
| InChi Key | HKTFMFBUSSUPGJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCC[Sn](CCCC)(CCCC)C1=CN=C(S1)OCC |
| Isomeric SMILES | CCCC[Sn](CCCC)(CCCC)C1=CN=C(S1)OCC |
| PubChem CID | 16427118 |
| Molecular Weight | 418.2 |
