| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| A588549-5g | 5g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $43.90 |
| Synonyms | SCHEMBL155078 | A856979 | CS-M3559 | DTXSID20619855 | DS-18219 | FT-0698160 | Benzamide, 2-amino-N-(5-chloro-2-pyridinyl)-5-methoxy- | 2-amino-N-(5-chloro-pyridin-2-yl)-5-methoxy-benzamide | 2-Amino-N-(5-chloropyridin-2-yl)-5-methoxybenzamide | BCP18251 | |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Protected from light,Desiccated |
| Shipped In | Wet ice |
| IUPAC Name | 2-amino-N-(5-chloropyridin-2-yl)-5-methoxybenzamide |
|---|---|
| INCHI | InChI=1S/C13H12ClN3O2/c1-19-9-3-4-11(15)10(6-9)13(18)17-12-5-2-8(14)7-16-12/h2-7H,15H2,1H3,(H,16,17,18) |
| InChi Key | GCCIHZVIPXGAPR-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)N)C(=O)NC2=NC=C(C=C2)Cl |
| Isomeric SMILES | COC1=CC(=C(C=C1)N)C(=O)NC2=NC=C(C=C2)Cl |
| PubChem CID | 21906241 |
| Molecular Weight | 277.71 |
Starting at $10.90
