B2307408Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | 2982-54-9 | 4-benzyloxy-phenethylamine hcl | 2-(4-(benzyloxy)phenyl)ethanamine hydrochloride | Benzeneethanamine, 4-(phenylmethoxy)-, hydrochloride | 2-[4-(benzyloxy)phenyl]ethan-1-amine hydrochloride | 2-(4-benzyloxy-phenyl)-ethylamine hydrochloride | 2-(4-phenylmet |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
AI Insight
Names and Identifiers
| Pubchem Sid | 488188605 |
|---|---|
| IUPAC Name | 2-(4-phenylmethoxyphenyl)ethanamine;hydrochloride |
| INCHI | InChI=1S/C15H17NO.ClH/c16-11-10-13-6-8-15(9-7-13)17-12-14-4-2-1-3-5-14;/h1-9H,10-12,16H2;1H |
| InChi Key | GMEWDNMRTKWSEF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CCN.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CCN.Cl |
| PubChem CID | 200956 |
| Molecular Weight | 263.76 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart: