| SKU | Size | Availability | Price | Qty |
|---|---|---|---|---|
| B181084-1g | 1g | Available within 8-12 weeks(?) Production requires sourcing of materials. We appreciate your patience and understanding. | $351.90 |
| Synonyms | 1-(3-bromopropoxy)-4-nitrobenzene | 13094-50-3 | 4-(3-Bromopropoxy)nitrobenzene | 1-(GAMMA-BROMOPROPOXY)-4-NITROBENZENE | Benzene, 1-(3-bromopropoxy)-4-nitro- | MFCD00596643 | NSC93035 | NCIOpen2_005819 | SCHEMBL519168 | DTXSID60293931 | 3-bromopropyl 4-nitrophenyl ether | LIB |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | 1-(3-bromopropoxy)-4-nitrobenzene |
|---|---|
| INCHI | InChI=1S/C9H10BrNO3/c10-6-1-7-14-9-4-2-8(3-5-9)11(12)13/h2-5H,1,6-7H2 |
| InChi Key | LIBYGKUWXRBMPA-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCCBr |
| Isomeric SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCCBr |
| PubChem CID | 261128 |
| Molecular Weight | 260.1 |
